About N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide
N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide (PubChem CID 130229612) has the molecular formula C21H13Cl2F2N3O
and a molecular weight of 432.26 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide |
| PubChem CID | 130229612 |
| Molecular Formula | C21H13Cl2F2N3O |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide |
| SMILES | O=C(Nc1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H13Cl2F2N3O/c22-13-6-5-12(17(23)9-13)11-28-19-4-2-1-3-16(19)20(27-28)26-21(29)15-8-7-14(24)10-18(15)25/h1-10H,11H2,(H,26,27,29) |
| InChIKey | FBQQNHCKTFRLQR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide?
The IUPAC name of N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide (CID 130229612) is N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide.
What is the SMILES notation for N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide?
The canonical SMILES for N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide is O=C(Nc1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12)c1ccc(F)cc1F.
What is the InChIKey of N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide?
The InChIKey is FBQQNHCKTFRLQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13Cl2F2N3O/c22-13-6-5-12(17(23)9-13)11-28-19-4-2-1-3-16(19)20(27-28)26-21(29)15-8-7-14(24)10-18(15)25/h1-10H,11H2,(H,26,27,29).
What are the key properties of N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide?
N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide has a molecular weight of 432.26 g/mol, XLogP of 5.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]-2,4-difluorobenzamide is sourced from PubChem (CID 130229612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).