C23H20F6O4S — CID 130230346
5-(benzenesulfonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-2-oxocyclohexane-1-carbaldehyde (PubChem CID 130230346) has the molecular formula C23H20F6O4S and a molecular weight of 506.46 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-2-oxocyclohexane-1-carbaldehyde.
| Compound Name | 5-(benzenesulfonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-2-oxocyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 130230346 |
| Molecular Formula | C23H20F6O4S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 5-(benzenesulfonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-2-oxocyclohexane-1-carbaldehyde |
| SMILES | CC(c1ccc(C2(S(=O)(=O)c3ccccc3)CCC(=O)C(C=O)C2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H20F6O4S/c1-20(22(24,25)26,23(27,28)29)16-7-9-17(10-8-16)21(12-11-19(31)15(13-21)14-30)34(32,33)18-5-3-2-4-6-18/h2-10,14-15H,11-13H2,1H3 |
| InChIKey | LDQJZTBMQCSYQP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|