C23H31NO — CID 130231092
1,2,2,6,6-pentamethyl-4-[4-(4-methylphenyl)phenoxy]piperidine (PubChem CID 130231092) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-[4-(4-methylphenyl)phenoxy]piperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-[4-(4-methylphenyl)phenoxy]piperidine |
|---|---|
| PubChem CID | 130231092 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-[4-(4-methylphenyl)phenoxy]piperidine |
| SMILES | Cc1ccc(-c2ccc(OC3CC(C)(C)N(C)C(C)(C)C3)cc2)cc1 |
| InChI | InChI=1S/C23H31NO/c1-17-7-9-18(10-8-17)19-11-13-20(14-12-19)25-21-15-22(2,3)24(6)23(4,5)16-21/h7-14,21H,15-16H2,1-6H3 |
| InChIKey | KGHCEWAHJSCBJY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |