About 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one
3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one (PubChem CID 130232839) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one.
Molecular Properties
| Compound Name | 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one |
| PubChem CID | 130232839 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one |
| SMILES | CC(C)c1cc2[nH]c(=O)sc2nn1 |
| InChI | InChI=1S/C8H9N3OS/c1-4(2)5-3-6-7(11-10-5)13-8(12)9-6/h3-4H,1-2H3,(H,9,12) |
| InChIKey | MGJBMTMSNMGPNN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one?
The IUPAC name of 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one (CID 130232839) is 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one.
What is the SMILES notation for 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one?
The canonical SMILES for 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one is CC(C)c1cc2[nH]c(=O)sc2nn1.
What is the InChIKey of 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one?
The InChIKey is MGJBMTMSNMGPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-4(2)5-3-6-7(11-10-5)13-8(12)9-6/h3-4H,1-2H3,(H,9,12).
What are the key properties of 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one?
3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one has a molecular weight of 195.25 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-5H-[1,3]thiazolo[5,4-c]pyridazin-6-one is sourced from PubChem (CID 130232839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).