About N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine
N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine (PubChem CID 130232927) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine.
Molecular Properties
| Compound Name | N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine |
| PubChem CID | 130232927 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine |
| SMILES | C=CC(/C=C\C)=C(C)\N=C\C |
| InChI | InChI=1S/C10H15N/c1-5-8-10(6-2)9(4)11-7-3/h5-8H,2H2,1,3-4H3/b8-5-,10-9+,11-7+ |
| InChIKey | IDHUFADKIPRWGX-ANTQSHTOSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine?
The IUPAC name of N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine (CID 130232927) is N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine.
What is the SMILES notation for N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine?
The canonical SMILES for N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine is C=CC(/C=C\C)=C(C)\N=C\C.
What is the InChIKey of N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine?
The InChIKey is IDHUFADKIPRWGX-ANTQSHTOSA-N. The full InChI is InChI=1S/C10H15N/c1-5-8-10(6-2)9(4)11-7-3/h5-8H,2H2,1,3-4H3/b8-5-,10-9+,11-7+.
What are the key properties of N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine?
N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine has a molecular weight of 149.24 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,4Z)-3-ethenylhexa-2,4-dien-2-yl]ethanimine is sourced from PubChem (CID 130232927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).