About 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid
6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 13023313) has the molecular formula C8H14O6S
and a molecular weight of 238.26 g/mol. Its IUPAC name is 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid |
| PubChem CID | 13023313 |
| Molecular Formula | C8H14O6S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCSC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C8H14O6S/c1-2-15-8-5(11)3(9)4(10)6(14-8)7(12)13/h3-6,8-11H,2H2,1H3,(H,12,13) |
| InChIKey | XJFLTPWYCFDKGU-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid?
The IUPAC name of 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid (CID 13023313) is 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid.
What is the SMILES notation for 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid?
The canonical SMILES for 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid is CCSC1OC(C(=O)O)C(O)C(O)C1O.
What is the InChIKey of 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid?
The InChIKey is XJFLTPWYCFDKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O6S/c1-2-15-8-5(11)3(9)4(10)6(14-8)7(12)13/h3-6,8-11H,2H2,1H3,(H,12,13).
What are the key properties of 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid?
6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid has a molecular weight of 238.26 g/mol, XLogP of -1.37, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid is sourced from PubChem (CID 13023313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).