C32H32F5NO4S — CID 130233215
[6-(2-fluoro-4-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl] trifluoromethanesulfonate (PubChem CID 130233215) has the molecular formula C32H32F5NO4S and a molecular weight of 621.67 g/mol. Its IUPAC name is [6-(2-fluoro-4-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-(2-fluoro-4-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130233215 |
| Molecular Formula | C32H32F5NO4S |
| Molecular Weight | 621.67 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | [6-(2-fluoro-4-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(C2=C(c3ccc(O[C@H]4CCN(CCCF)C4)cc3)c3ccc(OS(=O)(=O)C(F)(F)F)cc3CCC2)c(F)c1 |
| InChI | InChI=1S/C32H32F5NO4S/c1-21-6-12-28(30(34)18-21)29-5-2-4-23-19-25(42-43(39,40)32(35,36)37)11-13-27(23)31(29)22-7-9-24(10-8-22)41-26-14-17-38(20-26)16-3-15-33/h6-13,18-19,26H,2-5,14-17,20H2,1H3/t26-/m0/s1 |
| InChIKey | UCSNSBSIOIAODE-SANMLTNESA-N |
| XLogP | 7.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.67 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|