C20H24N6O3 — CID 13023326
7-[3-[2-(5-hydroxy-1H-indol-3-yl)ethylamino]propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 13023326) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 7-[3-[2-(5-hydroxy-1H-indol-3-yl)ethylamino]propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[3-[2-(5-hydroxy-1H-indol-3-yl)ethylamino]propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 13023326 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 7-[3-[2-(5-hydroxy-1H-indol-3-yl)ethylamino]propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCCNCCc2c[nH]c3ccc(O)cc23)n(C)c1=O |
| InChI | InChI=1S/C20H24N6O3/c1-24-18-17(19(28)25(2)20(24)29)26(12-23-18)9-3-7-21-8-6-13-11-22-16-5-4-14(27)10-15(13)16/h4-5,10-12,21-22,27H,3,6-9H2,1-2H3 |
| InChIKey | RFZVKRQECNKSDV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|