C15H24F3NO2 — CID 130233326
3-propan-2-yl-1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrolidine-2,5-dione (PubChem CID 130233326) has the molecular formula C15H24F3NO2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 3-propan-2-yl-1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrolidine-2,5-dione.
| Compound Name | 3-propan-2-yl-1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130233326 |
| Molecular Formula | C15H24F3NO2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-propan-2-yl-1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)C1CC(=O)N(CCCCC[C@@H](C)C(F)(F)F)C1=O |
| InChI | InChI=1S/C15H24F3NO2/c1-10(2)12-9-13(20)19(14(12)21)8-6-4-5-7-11(3)15(16,17)18/h10-12H,4-9H2,1-3H3/t11-,12?/m1/s1 |
| InChIKey | WSEZYXJOKZUKGT-JHJMLUEUSA-N |
| XLogP | 3.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|