C20H22O8 — CID 130234862
(E)-4-[8-hydroxy-6-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]but-3-en-2-one (PubChem CID 130234862) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is (E)-4-[8-hydroxy-6-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]but-3-en-2-one.
| Compound Name | (E)-4-[8-hydroxy-6-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 130234862 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (E)-4-[8-hydroxy-6-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc2cc(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)cc(O)c2c1 |
| InChI | InChI=1S/C20H22O8/c1-10(22)2-3-11-4-5-12-7-13(8-15(23)14(12)6-11)27-20-19(26)18(25)17(24)16(9-21)28-20/h2-8,16-21,23-26H,9H2,1H3/b3-2+/t16?,17-,18?,19?,20-/m1/s1 |
| InChIKey | AUKBWGAXIHUEJL-OGIUIXFVSA-N |
| XLogP | 0.33 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|