C28H31NO7 — CID 130235161
[(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1,2-benzoxazole-3-carboxylate (PubChem CID 130235161) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is [(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1,2-benzoxazole-3-carboxylate.
| Compound Name | [(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1,2-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 130235161 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | [(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1,2-benzoxazole-3-carboxylate |
| SMILES | CC1=CC23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1noc2ccccc12)[C@H]1[C@@H](CC3C)C1(C)C |
| InChI | InChI=1S/C28H31NO7/c1-13-11-27-14(2)9-18-20(26(18,3)4)17(23(27)32)10-15(12-30)22(31)28(27,34)24(13)35-25(33)21-16-7-5-6-8-19(16)36-29-21/h5-8,10-11,14,17-18,20,22,24,30-31,34H,9,12H2,1-4H3/t14?,17-,18+,20-,22+,24-,27?,28-/m0/s1 |
| InChIKey | YFYBWEPOLKUTJF-WMFUUUOWSA-N |
| XLogP | 2.82 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|