C33H40N2O6 — CID 130235194
[(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] 3-phenylimidazole-4-carboxylate (PubChem CID 130235194) has the molecular formula C33H40N2O6 and a molecular weight of 560.69 g/mol. Its IUPAC name is [(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] 3-phenylimidazole-4-carboxylate.
| Compound Name | [(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] 3-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 130235194 |
| Molecular Formula | C33H40N2O6 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] 3-phenylimidazole-4-carboxylate |
| SMILES | CC1=C[C@]23C(O)[C@@H](C=C4COC(C)(C)O[C@H]4[C@]2(O)[C@H]1OC(=O)c1cncn1-c1ccccc1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C33H40N2O6/c1-18-14-32-19(2)12-23-25(30(23,3)4)22(26(32)36)13-20-16-39-31(5,6)41-28(20)33(32,38)27(18)40-29(37)24-15-34-17-35(24)21-10-8-7-9-11-21/h7-11,13-15,17,19,22-23,25-28,36,38H,12,16H2,1-6H3/t19-,22+,23-,25+,26?,27+,28-,32+,33-/m1/s1 |
| InChIKey | JGHWWVABPPMTRD-XAPWUHTASA-N |
| XLogP | 4.46 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|