C33H40N2O6 — CID 130235195
[(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 3-phenylimidazole-4-carboxylate (PubChem CID 130235195) has the molecular formula C33H40N2O6 and a molecular weight of 560.69 g/mol. Its IUPAC name is [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 3-phenylimidazole-4-carboxylate.
| Compound Name | [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 3-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 130235195 |
| Molecular Formula | C33H40N2O6 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 3-phenylimidazole-4-carboxylate |
| SMILES | CC1=CC23C(=O)[C@@H](C=C4COC(C)(C)O[C@H]4[C@]2(O)[C@H]1OC(=O)c1cncn1-c1ccccc1)C(C)(C)[C@@H](C)CC3C |
| InChI | InChI=1S/C33H40N2O6/c1-19-15-32-21(3)13-20(2)30(4,5)24(26(32)36)14-22-17-39-31(6,7)41-28(22)33(32,38)27(19)40-29(37)25-16-34-18-35(25)23-11-9-8-10-12-23/h8-12,14-16,18,20-21,24,27-28,38H,13,17H2,1-7H3/t20-,21?,24+,27-,28+,32?,33+/m0/s1 |
| InChIKey | VCESQPPUZLCTKY-IQZAADHFSA-N |
| XLogP | 5.05 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|