C28H43NO6 — CID 130235268
[(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] N,N-diethylcarbamate (PubChem CID 130235268) has the molecular formula C28H43NO6 and a molecular weight of 489.65 g/mol. Its IUPAC name is [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] N,N-diethylcarbamate.
| Compound Name | [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 130235268 |
| Molecular Formula | C28H43NO6 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[C@H]1C(C)=CC23C(=O)[C@@H](C=C4COC(C)(C)O[C@H]4[C@]12O)C(C)(C)[C@@H](C)CC3C |
| InChI | InChI=1S/C28H43NO6/c1-10-29(11-2)24(31)34-22-16(3)14-27-18(5)12-17(4)25(6,7)20(21(27)30)13-19-15-33-26(8,9)35-23(19)28(22,27)32/h13-14,17-18,20,22-23,32H,10-12,15H2,1-9H3/t17-,18?,20+,22-,23+,27?,28+/m0/s1 |
| InChIKey | HBRNZBVQNMCQTI-LCHRCRMNSA-N |
| XLogP | 4.49 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|