C29H43NO6 — CID 130235270
[(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] piperidine-1-carboxylate (PubChem CID 130235270) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is [(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] piperidine-1-carboxylate.
| Compound Name | [(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130235270 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | [(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] piperidine-1-carboxylate |
| SMILES | CC1=C[C@]23C(O)[C@@H](C=C4COC(C)(C)O[C@H]4[C@]2(O)[C@@H]1OC(=O)N1CCCCC1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C29H43NO6/c1-16-14-28-17(2)12-20-21(26(20,3)4)19(22(28)31)13-18-15-34-27(5,6)36-24(18)29(28,33)23(16)35-25(32)30-10-8-7-9-11-30/h13-14,17,19-24,31,33H,7-12,15H2,1-6H3/t17-,19+,20-,21+,22?,23-,24-,28+,29-/m1/s1 |
| InChIKey | GCJOFHJVIORGDO-GMEQVWAISA-N |
| XLogP | 4.04 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|