C23H17ClN4O2S — CID 1302353
3-benzamido-N-[5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 1302353) has the molecular formula C23H17ClN4O2S and a molecular weight of 448.94 g/mol. Its IUPAC name is 3-benzamido-N-[5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-benzamido-N-[5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 1302353 |
| Molecular Formula | C23H17ClN4O2S |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 3-benzamido-N-[5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2nnc(Cc3ccc(Cl)cc3)s2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H17ClN4O2S/c24-18-11-9-15(10-12-18)13-20-27-28-23(31-20)26-22(30)17-7-4-8-19(14-17)25-21(29)16-5-2-1-3-6-16/h1-12,14H,13H2,(H,25,29)(H,26,28,30) |
| InChIKey | UVMJXOOFHGRTTB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |