C30H41NO7 — CID 130235387
[(1R,4S,5S,6R,9S,10R,14R)-5,6,15-trihydroxy-7-(hydroxymethyl)-3,11,11,12,14-pentamethyl-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] N-(2-methoxyphenyl)-N-methylcarbamate (PubChem CID 130235387) has the molecular formula C30H41NO7 and a molecular weight of 527.66 g/mol. Its IUPAC name is [(1R,4S,5S,6R,9S,10R,14R)-5,6,15-trihydroxy-7-(hydroxymethyl)-3,11,11,12,14-pentamethyl-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] N-(2-methoxyphenyl)-N-methylcarbamate.
| Compound Name | [(1R,4S,5S,6R,9S,10R,14R)-5,6,15-trihydroxy-7-(hydroxymethyl)-3,11,11,12,14-pentamethyl-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] N-(2-methoxyphenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 130235387 |
| Molecular Formula | C30H41NO7 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | [(1R,4S,5S,6R,9S,10R,14R)-5,6,15-trihydroxy-7-(hydroxymethyl)-3,11,11,12,14-pentamethyl-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] N-(2-methoxyphenyl)-N-methylcarbamate |
| SMILES | COc1ccccc1N(C)C(=O)O[C@H]1C(C)=C[C@]23C(O)[C@@H](C=C(CO)[C@@H](O)[C@]12O)[C@@H]1C(C)(C)C1(C)C[C@H]3C |
| InChI | InChI=1S/C30H41NO7/c1-16-13-29-17(2)14-28(5)22(27(28,3)4)19(24(29)34)12-18(15-32)23(33)30(29,36)25(16)38-26(35)31(6)20-10-8-9-11-21(20)37-7/h8-13,17,19,22-25,32-34,36H,14-15H2,1-7H3/t17-,19+,22-,23-,24?,25+,28?,29+,30+/m1/s1 |
| InChIKey | MXALHCMJJDNSDC-WLVVAISCSA-N |
| XLogP | 3.29 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|