C30H40O7 — CID 130235536
[(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 2,4-dimethylfuran-3-carboxylate (PubChem CID 130235536) has the molecular formula C30H40O7 and a molecular weight of 512.64 g/mol. Its IUPAC name is [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 2,4-dimethylfuran-3-carboxylate.
| Compound Name | [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 2,4-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 130235536 |
| Molecular Formula | C30H40O7 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 2,4-dimethylfuran-3-carboxylate |
| SMILES | CC1=CC23C(=O)[C@@H](C=C4COC(C)(C)O[C@H]4[C@]2(O)[C@H]1OC(=O)c1c(C)coc1C)C(C)(C)[C@@H](C)CC3C |
| InChI | InChI=1S/C30H40O7/c1-15-12-29-18(4)10-17(3)27(6,7)21(23(29)31)11-20-14-35-28(8,9)37-25(20)30(29,33)24(15)36-26(32)22-16(2)13-34-19(22)5/h11-13,17-18,21,24-25,33H,10,14H2,1-9H3/t17-,18?,21+,24-,25+,29?,30+/m0/s1 |
| InChIKey | CEKKRBMMMYYZBX-OJGVYAMJSA-N |
| XLogP | 5.08 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|