C26H36N2O6 — CID 130235566
[(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] N-(1-cyanopropan-2-yl)-N-methylcarbamate (PubChem CID 130235566) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is [(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] N-(1-cyanopropan-2-yl)-N-methylcarbamate.
| Compound Name | [(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] N-(1-cyanopropan-2-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 130235566 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | [(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] N-(1-cyanopropan-2-yl)-N-methylcarbamate |
| SMILES | CC1=CC23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)N(C)C(C)CC#N)[C@H]1[C@@H](CC3C)C1(C)C |
| InChI | InChI=1S/C26H36N2O6/c1-13-11-25-14(2)9-18-19(24(18,4)5)17(21(25)31)10-16(12-29)20(30)26(25,33)22(13)34-23(32)28(6)15(3)7-8-27/h10-11,14-15,17-20,22,29-30,33H,7,9,12H2,1-6H3/t14?,15?,17-,18+,19-,20+,22-,25?,26-/m0/s1 |
| InChIKey | UONDNOHAKYIHGR-AVPPPQMFSA-N |
| XLogP | 2.19 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|