About hexane-1,3,4-triol
hexane-1,3,4-triol (PubChem CID 13023573) has the molecular formula C6H14O3
and a molecular weight of 134.18 g/mol. Its IUPAC name is hexane-1,3,4-triol.
Molecular Properties
| Compound Name | hexane-1,3,4-triol |
| PubChem CID | 13023573 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | hexane-1,3,4-triol |
| SMILES | CCC(O)C(O)CCO |
| InChI | InChI=1S/C6H14O3/c1-2-5(8)6(9)3-4-7/h5-9H,2-4H2,1H3 |
| InChIKey | KJPYHRLBRSHUOV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hexane-1,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,3,4-triol?
The IUPAC name of hexane-1,3,4-triol (CID 13023573) is hexane-1,3,4-triol.
What is the SMILES notation for hexane-1,3,4-triol?
The canonical SMILES for hexane-1,3,4-triol is CCC(O)C(O)CCO.
What is the InChIKey of hexane-1,3,4-triol?
The InChIKey is KJPYHRLBRSHUOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3/c1-2-5(8)6(9)3-4-7/h5-9H,2-4H2,1H3.
What are the key properties of hexane-1,3,4-triol?
hexane-1,3,4-triol has a molecular weight of 134.18 g/mol, XLogP of -0.50, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,3,4-triol is sourced from PubChem (CID 13023573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).