C16H22O2 — CID 13023588
(2S,3S)-3-cyclohexyl-3-hydroxy-2-methyl-1-phenylpropan-1-one (PubChem CID 13023588) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2S,3S)-3-cyclohexyl-3-hydroxy-2-methyl-1-phenylpropan-1-one.
| Compound Name | (2S,3S)-3-cyclohexyl-3-hydroxy-2-methyl-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 13023588 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2S,3S)-3-cyclohexyl-3-hydroxy-2-methyl-1-phenylpropan-1-one |
| SMILES | C[C@H](C(=O)c1ccccc1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C16H22O2/c1-12(15(17)13-8-4-2-5-9-13)16(18)14-10-6-3-7-11-14/h2,4-5,8-9,12,14,16,18H,3,6-7,10-11H2,1H3/t12-,16-/m1/s1 |
| InChIKey | PIBLHZAVEPUFNE-MLGOLLRUSA-N |
| XLogP | 3.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |