C21H36N6O8 — CID 130236138
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2S)-2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-methylbutanoic acid (PubChem CID 130236138) has the molecular formula C21H36N6O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2S)-2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2S)-2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 130236138 |
| Molecular Formula | C21H36N6O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2S)-2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NNC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O.NC(=O)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C15H23N3O5.C6H13N3O3/c1-10(2)14(15(22)23)17-16-11(19)6-4-3-5-9-18-12(20)7-8-13(18)21;7-4(5(10)11)2-1-3-9-6(8)12/h7-8,10,14,17H,3-6,9H2,1-2H3,(H,16,19)(H,22,23);4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t14-;4-/m00/s1 |
| InChIKey | DOXUTPQPKLFXPP-SZOKBQDQSA-N |
| XLogP | -0.95 |
| TPSA | 234.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|