C20H23N7O4 — CID 130236185
(10S)-9,10-dihydroxy-16-methyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione (PubChem CID 130236185) has the molecular formula C20H23N7O4 and a molecular weight of 425.45 g/mol. Its IUPAC name is (10S)-9,10-dihydroxy-16-methyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione.
| Compound Name | (10S)-9,10-dihydroxy-16-methyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione |
|---|---|
| PubChem CID | 130236185 |
| Molecular Formula | C20H23N7O4 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (10S)-9,10-dihydroxy-16-methyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione |
| SMILES | Cn1cc2c(n1)C(=O)NC[C@H](O)C(O)CCCn1cc(cn1)-c1cccc(n1)C(=O)N2 |
| InChI | InChI=1S/C20H23N7O4/c1-26-11-15-18(25-26)20(31)21-9-17(29)16(28)6-3-7-27-10-12(8-22-27)13-4-2-5-14(23-13)19(30)24-15/h2,4-5,8,10-11,16-17,28-29H,3,6-7,9H2,1H3,(H,21,31)(H,24,30)/t16?,17-/m0/s1 |
| InChIKey | FVYUSYCCSKFISZ-DJNXLDHESA-N |
| XLogP | 0.18 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |