C24H20F11NO3S — CID 130236395
4-[(E)-4,4-difluoro-3-(3,4,5-trifluorophenyl)pent-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236395) has the molecular formula C24H20F11NO3S and a molecular weight of 611.47 g/mol. Its IUPAC name is 4-[(E)-4,4-difluoro-3-(3,4,5-trifluorophenyl)pent-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(E)-4,4-difluoro-3-(3,4,5-trifluorophenyl)pent-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236395 |
| Molecular Formula | C24H20F11NO3S |
| Molecular Weight | 611.47 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | 4-[(E)-4,4-difluoro-3-(3,4,5-trifluorophenyl)pent-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@H](CS(=O)(=O)CC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(F)c(F)c(F)c2)C(C)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H20F11NO3S/c1-12(10-40(38,39)11-23(30,31)32)36-21(37)15-5-3-13(7-17(15)24(33,34)35)4-6-16(22(2,28)29)14-8-18(25)20(27)19(26)9-14/h3-9,12,16H,10-11H2,1-2H3,(H,36,37)/b6-4+/t12-,16?/m1/s1 |
| InChIKey | YRAHFIGAHDFBSI-PUPBNDIJSA-N |
| XLogP | 6.67 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|