About (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride
(2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride (PubChem CID 130236586) has the molecular formula C7H14ClF3N2OS
and a molecular weight of 266.72 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride |
| PubChem CID | 130236586 |
| Molecular Formula | C7H14ClF3N2OS |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride |
| SMILES | CSCC[C@@H](N)C(=O)NCC(F)(F)F.Cl |
| InChI | InChI=1S/C7H13F3N2OS.ClH/c1-14-3-2-5(11)6(13)12-4-7(8,9)10;/h5H,2-4,11H2,1H3,(H,12,13);1H/t5-;/m1./s1 |
| InChIKey | NZNAPQIILCUQLD-NUBCRITNSA-N |
| XLogP | 1.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride?
The IUPAC name of (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride (CID 130236586) is (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride.
What is the SMILES notation for (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride?
The canonical SMILES for (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride is CSCC[C@@H](N)C(=O)NCC(F)(F)F.Cl.
What is the InChIKey of (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride?
The InChIKey is NZNAPQIILCUQLD-NUBCRITNSA-N. The full InChI is InChI=1S/C7H13F3N2OS.ClH/c1-14-3-2-5(11)6(13)12-4-7(8,9)10;/h5H,2-4,11H2,1H3,(H,12,13);1H/t5-;/m1./s1.
What are the key properties of (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride?
(2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride has a molecular weight of 266.72 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-4-methylsulfanyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride is sourced from PubChem (CID 130236586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).