C23H14BrF13N2O2 — CID 130236753
4-[(Z)-3-[3-bromo-4-(trifluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 130236753) has the molecular formula C23H14BrF13N2O2 and a molecular weight of 677.25 g/mol. Its IUPAC name is 4-[(Z)-3-[3-bromo-4-(trifluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-[3-bromo-4-(trifluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236753 |
| Molecular Formula | C23H14BrF13N2O2 |
| Molecular Weight | 677.25 g/mol |
| Exact Mass | 676.00 |
| IUPAC Name | 4-[(Z)-3-[3-bromo-4-(trifluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1ccc(/C(F)=C/C(c2ccc(C(F)(F)F)c(Br)c2)C(F)(F)F)cc1C(F)(F)F)NCC(F)(F)F |
| InChI | InChI=1S/C23H14BrF13N2O2/c24-16-6-10(2-4-13(16)21(29,30)31)14(22(32,33)34)7-17(25)11-1-3-12(15(5-11)23(35,36)37)19(41)38-8-18(40)39-9-20(26,27)28/h1-7,14H,8-9H2,(H,38,41)(H,39,40)/b17-7- |
| InChIKey | PLLOBVIZGRGVJU-IDUWFGFVSA-N |
| XLogP | 7.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.25 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |