C22H14BrClF10N2O2 — CID 130236873
4-[(Z)-3-(4-bromo-3-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 130236873) has the molecular formula C22H14BrClF10N2O2 and a molecular weight of 643.70 g/mol. Its IUPAC name is 4-[(Z)-3-(4-bromo-3-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(4-bromo-3-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236873 |
| Molecular Formula | C22H14BrClF10N2O2 |
| Molecular Weight | 643.70 g/mol |
| Exact Mass | 641.98 |
| IUPAC Name | 4-[(Z)-3-(4-bromo-3-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1ccc(/C(F)=C/C(c2ccc(Br)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)NCC(F)(F)F |
| InChI | InChI=1S/C22H14BrClF10N2O2/c23-15-4-2-10(6-16(15)24)13(21(29,30)31)7-17(25)11-1-3-12(14(5-11)22(32,33)34)19(38)35-8-18(37)36-9-20(26,27)28/h1-7,13H,8-9H2,(H,35,38)(H,36,37)/b17-7- |
| InChIKey | NKGCQVMCCMUWTJ-IDUWFGFVSA-N |
| XLogP | 7.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.70 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |