C24H16BrF13N2O2 — CID 130236948
4-[(Z)-3-[3-bromo-4-(trifluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236948) has the molecular formula C24H16BrF13N2O2 and a molecular weight of 691.28 g/mol. Its IUPAC name is 4-[(Z)-3-[3-bromo-4-(trifluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-[3-bromo-4-(trifluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236948 |
| Molecular Formula | C24H16BrF13N2O2 |
| Molecular Weight | 691.28 g/mol |
| Exact Mass | 690.02 |
| IUPAC Name | 4-[(Z)-3-[3-bromo-4-(trifluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C(F)=C/C(c2ccc(C(F)(F)F)c(Br)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C24H16BrF13N2O2/c1-10(19(41)39-9-21(27,28)29)40-20(42)13-4-2-12(6-16(13)24(36,37)38)18(26)8-15(23(33,34)35)11-3-5-14(17(25)7-11)22(30,31)32/h2-8,10,15H,9H2,1H3,(H,39,41)(H,40,42)/b18-8-/t10-,15?/m1/s1 |
| InChIKey | GDSPEOCLAMULNM-IRSKATQBSA-N |
| XLogP | 7.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.28 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |