About (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol
(5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol (PubChem CID 13023699) has the molecular formula C11H22OSi
and a molecular weight of 198.38 g/mol. Its IUPAC name is (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol.
Molecular Properties
| Compound Name | (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol |
| PubChem CID | 13023699 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol |
| SMILES | C=C(C)C(O)C/C(=C/C)[Si](C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-7-10(13(4,5)6)8-11(12)9(2)3/h7,11-12H,2,8H2,1,3-6H3/b10-7- |
| InChIKey | YPKCISAVSTXHLK-YFHOEESVSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol?
The IUPAC name of (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol (CID 13023699) is (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol.
What is the SMILES notation for (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol?
The canonical SMILES for (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol is C=C(C)C(O)C/C(=C/C)[Si](C)(C)C.
What is the InChIKey of (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol?
The InChIKey is YPKCISAVSTXHLK-YFHOEESVSA-N. The full InChI is InChI=1S/C11H22OSi/c1-7-10(13(4,5)6)8-11(12)9(2)3/h7,11-12H,2,8H2,1,3-6H3/b10-7-.
What are the key properties of (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol?
(5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol has a molecular weight of 198.38 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-2-methyl-5-trimethylsilylhepta-1,5-dien-3-ol is sourced from PubChem (CID 13023699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).