C12H24O3 — CID 13023729
8,8-dimethoxy-2,6-dimethyloctan-3-one (PubChem CID 13023729) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is 8,8-dimethoxy-2,6-dimethyloctan-3-one.
| Compound Name | 8,8-dimethoxy-2,6-dimethyloctan-3-one |
|---|---|
| PubChem CID | 13023729 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 8,8-dimethoxy-2,6-dimethyloctan-3-one |
| SMILES | COC(CC(C)CCC(=O)C(C)C)OC |
| InChI | InChI=1S/C12H24O3/c1-9(2)11(13)7-6-10(3)8-12(14-4)15-5/h9-10,12H,6-8H2,1-5H3 |
| InChIKey | OXOAWTBGZSIGOQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|