C26H30ClIN2O3 — CID 130237926
benzyl 4-(4-chlorophenyl)-1-[(1,1-dimethylazetidin-1-ium-3-yl)methyl]-6-methyl-2-oxo-3,4-dihydropyridine-5-carboxylate iodide (PubChem CID 130237926) has the molecular formula C26H30ClIN2O3 and a molecular weight of 580.89 g/mol. Its IUPAC name is benzyl 4-(4-chlorophenyl)-1-[(1,1-dimethylazetidin-1-ium-3-yl)methyl]-6-methyl-2-oxo-3,4-dihydropyridine-5-carboxylate iodide.
| Compound Name | benzyl 4-(4-chlorophenyl)-1-[(1,1-dimethylazetidin-1-ium-3-yl)methyl]-6-methyl-2-oxo-3,4-dihydropyridine-5-carboxylate iodide |
|---|---|
| PubChem CID | 130237926 |
| Molecular Formula | C26H30ClIN2O3 |
| Molecular Weight | 580.89 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | benzyl 4-(4-chlorophenyl)-1-[(1,1-dimethylazetidin-1-ium-3-yl)methyl]-6-methyl-2-oxo-3,4-dihydropyridine-5-carboxylate iodide |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(c2ccc(Cl)cc2)CC(=O)N1CC1C[N+](C)(C)C1.[I-] |
| InChI | InChI=1S/C26H30ClN2O3.HI/c1-18-25(26(31)32-17-19-7-5-4-6-8-19)23(21-9-11-22(27)12-10-21)13-24(30)28(18)14-20-15-29(2,3)16-20;/h4-12,20,23H,13-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZJDBAKVYVDKTLR-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.89 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|