C17H21ClN2O5 — CID 130238807
3-(2-chloro-4,6-dimethylphenyl)-4,8-dihydroxy-1-(hydroxymethoxy)-1,8-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 130238807) has the molecular formula C17H21ClN2O5 and a molecular weight of 368.82 g/mol. Its IUPAC name is 3-(2-chloro-4,6-dimethylphenyl)-4,8-dihydroxy-1-(hydroxymethoxy)-1,8-diazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-(2-chloro-4,6-dimethylphenyl)-4,8-dihydroxy-1-(hydroxymethoxy)-1,8-diazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 130238807 |
| Molecular Formula | C17H21ClN2O5 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-(2-chloro-4,6-dimethylphenyl)-4,8-dihydroxy-1-(hydroxymethoxy)-1,8-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | Cc1cc(C)c(C2=C(O)C3(CCN(O)CC3)N(OCO)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C17H21ClN2O5/c1-10-7-11(2)13(12(18)8-10)14-15(22)17(3-5-19(24)6-4-17)20(16(14)23)25-9-21/h7-8,21-22,24H,3-6,9H2,1-2H3 |
| InChIKey | DCLJDPZNUHCJMB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|