About 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine
1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine (PubChem CID 130239233) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine.
Molecular Properties
| Compound Name | 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine |
| PubChem CID | 130239233 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine |
| SMILES | C=C/C(=N\C)C1=C(C)C=CCC1C |
| InChI | InChI=1S/C12H17N/c1-5-11(13-4)12-9(2)7-6-8-10(12)3/h5-7,10H,1,8H2,2-4H3/b13-11+ |
| InChIKey | KYNAYUWFGBCFOK-ACCUITESSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine?
The IUPAC name of 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine (CID 130239233) is 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine.
What is the SMILES notation for 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine?
The canonical SMILES for 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine is C=C/C(=N\C)C1=C(C)C=CCC1C.
What is the InChIKey of 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine?
The InChIKey is KYNAYUWFGBCFOK-ACCUITESSA-N. The full InChI is InChI=1S/C12H17N/c1-5-11(13-4)12-9(2)7-6-8-10(12)3/h5-7,10H,1,8H2,2-4H3/b13-11+.
What are the key properties of 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine?
1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine has a molecular weight of 175.27 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-methylprop-2-en-1-imine is sourced from PubChem (CID 130239233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).