About 7H-cyclohepta[d][1,3]thiazole-7-thiol
7H-cyclohepta[d][1,3]thiazole-7-thiol (PubChem CID 130239344) has the molecular formula C8H7NS2
and a molecular weight of 181.28 g/mol. Its IUPAC name is 7H-cyclohepta[d][1,3]thiazole-7-thiol.
Molecular Properties
| Compound Name | 7H-cyclohepta[d][1,3]thiazole-7-thiol |
| PubChem CID | 130239344 |
| Molecular Formula | C8H7NS2 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 7H-cyclohepta[d][1,3]thiazole-7-thiol |
| SMILES | SC1C=CC=c2ncsc2=C1 |
| InChI | InChI=1S/C8H7NS2/c10-6-2-1-3-7-8(4-6)11-5-9-7/h1-6,10H |
| InChIKey | NSUFXRHHYRSOTQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7H-cyclohepta[d][1,3]thiazole-7-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-cyclohepta[d][1,3]thiazole-7-thiol?
The IUPAC name of 7H-cyclohepta[d][1,3]thiazole-7-thiol (CID 130239344) is 7H-cyclohepta[d][1,3]thiazole-7-thiol.
What is the SMILES notation for 7H-cyclohepta[d][1,3]thiazole-7-thiol?
The canonical SMILES for 7H-cyclohepta[d][1,3]thiazole-7-thiol is SC1C=CC=c2ncsc2=C1.
What is the InChIKey of 7H-cyclohepta[d][1,3]thiazole-7-thiol?
The InChIKey is NSUFXRHHYRSOTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS2/c10-6-2-1-3-7-8(4-6)11-5-9-7/h1-6,10H.
What are the key properties of 7H-cyclohepta[d][1,3]thiazole-7-thiol?
7H-cyclohepta[d][1,3]thiazole-7-thiol has a molecular weight of 181.28 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-cyclohepta[d][1,3]thiazole-7-thiol is sourced from PubChem (CID 130239344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).