About (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine
(4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine (PubChem CID 130239492) has the molecular formula C10H9NS
and a molecular weight of 175.26 g/mol. Its IUPAC name is (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine.
Molecular Properties
| Compound Name | (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine |
| PubChem CID | 130239492 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine |
| SMILES | C#C/C=C1\C/C(=C\C=C)N=CS1 |
| InChI | InChI=1S/C10H9NS/c1-3-5-9-7-10(6-4-2)12-8-11-9/h2-3,5-6,8H,1,7H2/b9-5+,10-6+ |
| InChIKey | RPDPRMMENUXRAE-NXZHAISVSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine?
The IUPAC name of (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine (CID 130239492) is (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine.
What is the SMILES notation for (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine?
The canonical SMILES for (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine is C#C/C=C1\C/C(=C\C=C)N=CS1.
What is the InChIKey of (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine?
The InChIKey is RPDPRMMENUXRAE-NXZHAISVSA-N. The full InChI is InChI=1S/C10H9NS/c1-3-5-9-7-10(6-4-2)12-8-11-9/h2-3,5-6,8H,1,7H2/b9-5+,10-6+.
What are the key properties of (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine?
(4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine has a molecular weight of 175.26 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6E)-4-prop-2-enylidene-6-prop-2-ynylidene-1,3-thiazine is sourced from PubChem (CID 130239492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).