C9H14OS — CID 130239649
(3E,5E)-3-methyl-6-sulfanylocta-3,5,7-trien-1-ol (PubChem CID 130239649) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is (3E,5E)-3-methyl-6-sulfanylocta-3,5,7-trien-1-ol.
| Compound Name | (3E,5E)-3-methyl-6-sulfanylocta-3,5,7-trien-1-ol |
|---|---|
| PubChem CID | 130239649 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | (3E,5E)-3-methyl-6-sulfanylocta-3,5,7-trien-1-ol |
| SMILES | C=C/C(S)=C\C=C(/C)CCO |
| InChI | InChI=1S/C9H14OS/c1-3-9(11)5-4-8(2)6-7-10/h3-5,10-11H,1,6-7H2,2H3/b8-4+,9-5+ |
| InChIKey | XOMUFKGBMHYELS-KBXRYBNXSA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|