C39H60N2O5S — CID 130239774
tert-butyl (4S,5R)-4-[[4-[2-(3-butoxycarbonyl-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)ethyl]phenyl]methyl]-2,2-dimethyl-5-[(2-methylpropylamino)methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 130239774) has the molecular formula C39H60N2O5S and a molecular weight of 668.99 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[[4-[2-(3-butoxycarbonyl-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)ethyl]phenyl]methyl]-2,2-dimethyl-5-[(2-methylpropylamino)methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[[4-[2-(3-butoxycarbonyl-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)ethyl]phenyl]methyl]-2,2-dimethyl-5-[(2-methylpropylamino)methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 130239774 |
| Molecular Formula | C39H60N2O5S |
| Molecular Weight | 668.99 g/mol |
| Exact Mass | 668.42 |
| IUPAC Name | tert-butyl (4S,5R)-4-[[4-[2-(3-butoxycarbonyl-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)ethyl]phenyl]methyl]-2,2-dimethyl-5-[(2-methylpropylamino)methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(CCc2ccc(C[C@H]3[C@@H](CNCC(C)C)OC(C)(C)N3C(=O)OC(C)(C)C)cc2)sc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C39H60N2O5S/c1-11-12-21-44-35(42)34-29-23-38(7,8)20-19-32(29)47-33(34)18-17-27-13-15-28(16-14-27)22-30-31(25-40-24-26(2)3)45-39(9,10)41(30)36(43)46-37(4,5)6/h13-16,26,30-31,40H,11-12,17-25H2,1-10H3/t30-,31+/m0/s1 |
| InChIKey | VQDOBBJPONOICW-IOWSJCHKSA-N |
| XLogP | 8.53 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.99 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|