About 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid
5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (PubChem CID 130239880) has the molecular formula C21H25NO2S
and a molecular weight of 355.50 g/mol. Its IUPAC name is 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| PubChem CID | 130239880 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| SMILES | CC1(C)CCc2sc(-c3ccc(N4CCCC4)cc3)c(C(=O)O)c2C1 |
| InChI | InChI=1S/C21H25NO2S/c1-21(2)10-9-17-16(13-21)18(20(23)24)19(25-17)14-5-7-15(8-6-14)22-11-3-4-12-22/h5-8H,3-4,9-13H2,1-2H3,(H,23,24) |
| InChIKey | MOINVAHSGQNZSV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (CID 130239880) is 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid is CC1(C)CCc2sc(-c3ccc(N4CCCC4)cc3)c(C(=O)O)c2C1.
What is the InChIKey of 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid?
The InChIKey is MOINVAHSGQNZSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2S/c1-21(2)10-9-17-16(13-21)18(20(23)24)19(25-17)14-5-7-15(8-6-14)22-11-3-4-12-22/h5-8H,3-4,9-13H2,1-2H3,(H,23,24).
What are the key properties of 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid?
5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid has a molecular weight of 355.50 g/mol, XLogP of 5.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-(4-pyrrolidin-1-ylphenyl)-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 130239880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).