About N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide
N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide (PubChem CID 130240102) has the molecular formula C8H13FN2
and a molecular weight of 156.20 g/mol. Its IUPAC name is N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide |
| PubChem CID | 130240102 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide |
| SMILES | C/C=C\C(N/C=N/C)=C(/C)F |
| InChI | InChI=1S/C8H13FN2/c1-4-5-8(7(2)9)11-6-10-3/h4-6H,1-3H3,(H,10,11)/b5-4-,8-7- |
| InChIKey | WUZHBDCMPYUSHA-UTOQUPLUSA-N |
| XLogP | 2.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide?
The IUPAC name of N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide (CID 130240102) is N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide?
The canonical SMILES for N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide is C/C=C\C(N/C=N/C)=C(/C)F.
What is the InChIKey of N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide?
The InChIKey is WUZHBDCMPYUSHA-UTOQUPLUSA-N. The full InChI is InChI=1S/C8H13FN2/c1-4-5-8(7(2)9)11-6-10-3/h4-6H,1-3H3,(H,10,11)/b5-4-,8-7-.
What are the key properties of N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide?
N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide has a molecular weight of 156.20 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-N'-methylmethanimidamide is sourced from PubChem (CID 130240102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).