C16H20O2S — CID 130240126
5,5-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (PubChem CID 130240126) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
| Compound Name | 5,5-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 130240126 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 5,5-dimethyl-2-[(3Z)-penta-1,3-dien-2-yl]-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| SMILES | C=C(/C=C\C)c1sc2c(c1C(=O)O)CC(C)(C)CC2 |
| InChI | InChI=1S/C16H20O2S/c1-5-6-10(2)14-13(15(17)18)11-9-16(3,4)8-7-12(11)19-14/h5-6H,2,7-9H2,1,3-4H3,(H,17,18)/b6-5- |
| InChIKey | LWOZRICEQRBBHA-WAYWQWQTSA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|