C22H29N2+ — CID 130240313
[4-[(2E,4E)-5-[4-(dimethylamino)-4-methylcyclohexa-1,5-dien-1-yl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 130240313) has the molecular formula C22H29N2+ and a molecular weight of 321.49 g/mol. Its IUPAC name is [4-[(2E,4E)-5-[4-(dimethylamino)-4-methylcyclohexa-1,5-dien-1-yl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(2E,4E)-5-[4-(dimethylamino)-4-methylcyclohexa-1,5-dien-1-yl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 130240313 |
| Molecular Formula | C22H29N2+ |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | [4-[(2E,4E)-5-[4-(dimethylamino)-4-methylcyclohexa-1,5-dien-1-yl]penta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CN(C)C1(C)C=CC(/C=C/C=C/C=C2C=CC(=[N+](C)C)C=C2)=CC1 |
| InChI | InChI=1S/C22H29N2/c1-22(24(4)5)17-15-20(16-18-22)10-8-6-7-9-19-11-13-21(14-12-19)23(2)3/h6-17H,18H2,1-5H3/q+1/b7-6+,10-8+ |
| InChIKey | LVDIXCPHSVAASZ-LQPGMRSMSA-N |
| XLogP | 4.07 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|