C10H10N2O2S — CID 130240605
3-[(sulfanylamino)methyl]-1H-indole-2-carboxylic acid (PubChem CID 130240605) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-[(sulfanylamino)methyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[(sulfanylamino)methyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 130240605 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 3-[(sulfanylamino)methyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2ccccc2c1CNS |
| InChI | InChI=1S/C10H10N2O2S/c13-10(14)9-7(5-11-15)6-3-1-2-4-8(6)12-9/h1-4,11-12,15H,5H2,(H,13,14) |
| InChIKey | LQOFVSQNHAGKPU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|