C13H20S — CID 130240608
5,5-dimethyl-3-prop-1-en-2-yl-3,4,6,7-tetrahydro-2H-1-benzothiophene (PubChem CID 130240608) has the molecular formula C13H20S and a molecular weight of 208.37 g/mol. Its IUPAC name is 5,5-dimethyl-3-prop-1-en-2-yl-3,4,6,7-tetrahydro-2H-1-benzothiophene.
| Compound Name | 5,5-dimethyl-3-prop-1-en-2-yl-3,4,6,7-tetrahydro-2H-1-benzothiophene |
|---|---|
| PubChem CID | 130240608 |
| Molecular Formula | C13H20S |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5,5-dimethyl-3-prop-1-en-2-yl-3,4,6,7-tetrahydro-2H-1-benzothiophene |
| SMILES | C=C(C)C1CSC2=C1CC(C)(C)CC2 |
| InChI | InChI=1S/C13H20S/c1-9(2)11-8-14-12-5-6-13(3,4)7-10(11)12/h11H,1,5-8H2,2-4H3 |
| InChIKey | HFFRRLBXGXDAFJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|