About 9-iodo-8,9-dihydrodibenzofuran-3-amine
9-iodo-8,9-dihydrodibenzofuran-3-amine (PubChem CID 130240609) has the molecular formula C12H10INO
and a molecular weight of 311.12 g/mol. Its IUPAC name is 9-iodo-8,9-dihydrodibenzofuran-3-amine.
Molecular Properties
| Compound Name | 9-iodo-8,9-dihydrodibenzofuran-3-amine |
| PubChem CID | 130240609 |
| Molecular Formula | C12H10INO |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 9-iodo-8,9-dihydrodibenzofuran-3-amine |
| SMILES | Nc1ccc2c3c(oc2c1)C=CCC3I |
| InChI | InChI=1S/C12H10INO/c13-9-2-1-3-10-12(9)8-5-4-7(14)6-11(8)15-10/h1,3-6,9H,2,14H2 |
| InChIKey | IZKNKCUSVJNLBB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-iodo-8,9-dihydrodibenzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-iodo-8,9-dihydrodibenzofuran-3-amine?
The IUPAC name of 9-iodo-8,9-dihydrodibenzofuran-3-amine (CID 130240609) is 9-iodo-8,9-dihydrodibenzofuran-3-amine.
What is the SMILES notation for 9-iodo-8,9-dihydrodibenzofuran-3-amine?
The canonical SMILES for 9-iodo-8,9-dihydrodibenzofuran-3-amine is Nc1ccc2c3c(oc2c1)C=CCC3I.
What is the InChIKey of 9-iodo-8,9-dihydrodibenzofuran-3-amine?
The InChIKey is IZKNKCUSVJNLBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10INO/c13-9-2-1-3-10-12(9)8-5-4-7(14)6-11(8)15-10/h1,3-6,9H,2,14H2.
What are the key properties of 9-iodo-8,9-dihydrodibenzofuran-3-amine?
9-iodo-8,9-dihydrodibenzofuran-3-amine has a molecular weight of 311.12 g/mol, XLogP of 3.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-iodo-8,9-dihydrodibenzofuran-3-amine is sourced from PubChem (CID 130240609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).