About 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone
1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone (PubChem CID 130240709) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone.
Molecular Properties
| Compound Name | 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone |
| PubChem CID | 130240709 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone |
| SMILES | [H]/N=C/C(=O)C1(C(=C)C(O)O)CC1 |
| InChI | InChI=1S/C8H11NO3/c1-5(7(11)12)8(2-3-8)6(10)4-9/h4,7,9,11-12H,1-3H2/b9-4+ |
| InChIKey | WTMSDVOWGZWCBA-RUDMXATFSA-N |
| XLogP | -0.15 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone?
The IUPAC name of 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone (CID 130240709) is 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone.
What is the SMILES notation for 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone?
The canonical SMILES for 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone is [H]/N=C/C(=O)C1(C(=C)C(O)O)CC1.
What is the InChIKey of 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone?
The InChIKey is WTMSDVOWGZWCBA-RUDMXATFSA-N. The full InChI is InChI=1S/C8H11NO3/c1-5(7(11)12)8(2-3-8)6(10)4-9/h4,7,9,11-12H,1-3H2/b9-4+.
What are the key properties of 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone?
1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone has a molecular weight of 169.18 g/mol, XLogP of -0.15, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,3-dihydroxyprop-1-en-2-yl)cyclopropyl]-2-iminoethanone is sourced from PubChem (CID 130240709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).