About 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine
5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine (PubChem CID 130241257) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 130241257 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1c[nH]c2c1C=NCN2 |
| InChI | InChI=1S/C7H9N3/c1-5-2-9-7-6(5)3-8-4-10-7/h2-3,9-10H,4H2,1H3 |
| InChIKey | DFBNOAZEBZAOST-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine (CID 130241257) is 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine is Cc1c[nH]c2c1C=NCN2.
What is the InChIKey of 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is DFBNOAZEBZAOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-5-2-9-7-6(5)3-8-4-10-7/h2-3,9-10H,4H2,1H3.
What are the key properties of 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine?
5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 135.17 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 130241257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).