C24H33N5OS — CID 130241645
N-[(3Z,5Z)-3-aminoocta-3,5-dienyl]-2-[4-[cyclopropyl(methyl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]acetamide (PubChem CID 130241645) has the molecular formula C24H33N5OS and a molecular weight of 439.63 g/mol. Its IUPAC name is N-[(3Z,5Z)-3-aminoocta-3,5-dienyl]-2-[4-[cyclopropyl(methyl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]acetamide.
| Compound Name | N-[(3Z,5Z)-3-aminoocta-3,5-dienyl]-2-[4-[cyclopropyl(methyl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]acetamide |
|---|---|
| PubChem CID | 130241645 |
| Molecular Formula | C24H33N5OS |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N-[(3Z,5Z)-3-aminoocta-3,5-dienyl]-2-[4-[cyclopropyl(methyl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]acetamide |
| SMILES | CC/C=C\C=C(/N)CCNC(=O)Cc1nc(N(C)C2CC2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C24H33N5OS/c1-3-4-5-8-16(25)13-14-26-21(30)15-20-27-23(29(2)17-11-12-17)22-18-9-6-7-10-19(18)31-24(22)28-20/h4-5,8,17H,3,6-7,9-15,25H2,1-2H3,(H,26,30)/b5-4-,16-8- |
| InChIKey | SXEZKJLDTVAQDL-XRGWHMLESA-N |
| XLogP | 4.03 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|