C13H23BrN2 — CID 130242048
2-(4-bromocyclohexyl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine (PubChem CID 130242048) has the molecular formula C13H23BrN2 and a molecular weight of 287.25 g/mol. Its IUPAC name is 2-(4-bromocyclohexyl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine.
| Compound Name | 2-(4-bromocyclohexyl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 130242048 |
| Molecular Formula | C13H23BrN2 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-(4-bromocyclohexyl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine |
| SMILES | BrC1CCC(C2CN3CCCCC3N2)CC1 |
| InChI | InChI=1S/C13H23BrN2/c14-11-6-4-10(5-7-11)12-9-16-8-2-1-3-13(16)15-12/h10-13,15H,1-9H2 |
| InChIKey | WWWHKWQXYICVRW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|