C26H44O5 — CID 130242128
3-[4-ethyl-6-[(8S)-8-hydroxy-2,5,5,6,6-pentamethylnonan-2-yl]-1,3-dioxan-2-yl]benzene-1,2-diol (PubChem CID 130242128) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is 3-[4-ethyl-6-[(8S)-8-hydroxy-2,5,5,6,6-pentamethylnonan-2-yl]-1,3-dioxan-2-yl]benzene-1,2-diol.
| Compound Name | 3-[4-ethyl-6-[(8S)-8-hydroxy-2,5,5,6,6-pentamethylnonan-2-yl]-1,3-dioxan-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 130242128 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 3-[4-ethyl-6-[(8S)-8-hydroxy-2,5,5,6,6-pentamethylnonan-2-yl]-1,3-dioxan-2-yl]benzene-1,2-diol |
| SMILES | CCC1CC(C(C)(C)CCC(C)(C)C(C)(C)C[C@H](C)O)OC(c2cccc(O)c2O)O1 |
| InChI | InChI=1S/C26H44O5/c1-9-18-15-21(31-23(30-18)19-11-10-12-20(28)22(19)29)24(3,4)13-14-25(5,6)26(7,8)16-17(2)27/h10-12,17-18,21,23,27-29H,9,13-16H2,1-8H3/t17-,18?,21?,23?/m0/s1 |
| InChIKey | BCSLJZQERHIPRU-GDDLZOMKSA-N |
| XLogP | 6.31 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|