About 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid
2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid (PubChem CID 130242596) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid |
| PubChem CID | 130242596 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid |
| SMILES | CC1C=C(CC(=O)O)C=CC1N(C)C |
| InChI | InChI=1S/C11H17NO2/c1-8-6-9(7-11(13)14)4-5-10(8)12(2)3/h4-6,8,10H,7H2,1-3H3,(H,13,14) |
| InChIKey | SLYMVEKOIIUROO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid?
The IUPAC name of 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid (CID 130242596) is 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid?
The canonical SMILES for 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid is CC1C=C(CC(=O)O)C=CC1N(C)C.
What is the InChIKey of 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid?
The InChIKey is SLYMVEKOIIUROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-8-6-9(7-11(13)14)4-5-10(8)12(2)3/h4-6,8,10H,7H2,1-3H3,(H,13,14).
What are the key properties of 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid?
2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid has a molecular weight of 195.26 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)-3-methylcyclohexa-1,5-dien-1-yl]acetic acid is sourced from PubChem (CID 130242596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).